C42H54O6 — CID 58750857
1,1,2,2-tetrakis[4-[(2-methylpropan-2-yl)oxy]phenyl]ethane-1,2-diol (PubChem CID 58750857) has the molecular formula C42H54O6 and a molecular weight of 654.89 g/mol. Its IUPAC name is 1,1,2,2-tetrakis[4-[(2-methylpropan-2-yl)oxy]phenyl]ethane-1,2-diol.
| Compound Name | 1,1,2,2-tetrakis[4-[(2-methylpropan-2-yl)oxy]phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 58750857 |
| Molecular Formula | C42H54O6 |
| Molecular Weight | 654.89 g/mol |
| Exact Mass | 654.39 |
| IUPAC Name | 1,1,2,2-tetrakis[4-[(2-methylpropan-2-yl)oxy]phenyl]ethane-1,2-diol |
| SMILES | CC(C)(C)Oc1ccc(C(O)(c2ccc(OC(C)(C)C)cc2)C(O)(c2ccc(OC(C)(C)C)cc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C42H54O6/c1-37(2,3)45-33-21-13-29(14-22-33)41(43,30-15-23-34(24-16-30)46-38(4,5)6)42(44,31-17-25-35(26-18-31)47-39(7,8)9)32-19-27-36(28-20-32)48-40(10,11)12/h13-28,43-44H,1-12H3 |
| InChIKey | KANAREDCKGIJEE-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.89 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |