C40H52BO4- — CID 140853647
tetrakis[4-[(2-methylpropan-2-yl)oxy]phenyl]boranuide (PubChem CID 140853647) has the molecular formula C40H52BO4- and a molecular weight of 607.66 g/mol. Its IUPAC name is tetrakis[4-[(2-methylpropan-2-yl)oxy]phenyl]boranuide.
| Compound Name | tetrakis[4-[(2-methylpropan-2-yl)oxy]phenyl]boranuide |
|---|---|
| PubChem CID | 140853647 |
| Molecular Formula | C40H52BO4- |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.40 |
| IUPAC Name | tetrakis[4-[(2-methylpropan-2-yl)oxy]phenyl]boranuide |
| SMILES | CC(C)(C)Oc1ccc([B-](c2ccc(OC(C)(C)C)cc2)(c2ccc(OC(C)(C)C)cc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C40H52BO4/c1-37(2,3)42-33-21-13-29(14-22-33)41(30-15-23-34(24-16-30)43-38(4,5)6,31-17-25-35(26-18-31)44-39(7,8)9)32-19-27-36(28-20-32)45-40(10,11)12/h13-28H,1-12H3/q-1 |
| InChIKey | XBTDSNZIDSDOOW-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|