About bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium
bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium (PubChem CID 158294548) has the molecular formula C20H28O4Zr
and a molecular weight of 423.66 g/mol. Its IUPAC name is bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium.
Molecular Properties
| Compound Name | bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium |
| PubChem CID | 158294548 |
| Molecular Formula | C20H28O4Zr |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium |
| SMILES | CC(C)(C)Oc1ccc(O)cc1.CC(C)(C)Oc1ccc(O)cc1.[Zr] |
| InChI | InChI=1S/2C10H14O2.Zr/c2*1-10(2,3)12-9-6-4-8(11)5-7-9;/h2*4-7,11H,1-3H3; |
| InChIKey | WSMLTTSGAMTVRB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium?
The IUPAC name of bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium (CID 158294548) is bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium.
What is the SMILES notation for bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium?
The canonical SMILES for bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium is CC(C)(C)Oc1ccc(O)cc1.CC(C)(C)Oc1ccc(O)cc1.[Zr].
What is the InChIKey of bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium?
The InChIKey is WSMLTTSGAMTVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H14O2.Zr/c2*1-10(2,3)12-9-6-4-8(11)5-7-9;/h2*4-7,11H,1-3H3;.
What are the key properties of bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium?
bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium has a molecular weight of 423.66 g/mol, XLogP of 5.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-[(2-methylpropan-2-yl)oxy]phenol);zirconium is sourced from PubChem (CID 158294548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).