C11H15NO3 — CID 69040268
2-(4-hydroxyphenoxy)-N,2-dimethylpropanamide (PubChem CID 69040268) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(4-hydroxyphenoxy)-N,2-dimethylpropanamide.
| Compound Name | 2-(4-hydroxyphenoxy)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 69040268 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(4-hydroxyphenoxy)-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C11H15NO3/c1-11(2,10(14)12-3)15-9-6-4-8(13)5-7-9/h4-7,13H,1-3H3,(H,12,14) |
| InChIKey | XNLJSIWKBUJPMA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |