C25H22ClNO5 — CID 71499301
2-[4-(4-chlorobenzoyl)phenoxy]-N-[2-(4-hydroxyphenyl)-2-oxoethyl]-2-methylpropanamide (PubChem CID 71499301) has the molecular formula C25H22ClNO5 and a molecular weight of 451.91 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)phenoxy]-N-[2-(4-hydroxyphenyl)-2-oxoethyl]-2-methylpropanamide.
| Compound Name | 2-[4-(4-chlorobenzoyl)phenoxy]-N-[2-(4-hydroxyphenyl)-2-oxoethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 71499301 |
| Molecular Formula | C25H22ClNO5 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)phenoxy]-N-[2-(4-hydroxyphenyl)-2-oxoethyl]-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)NCC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H22ClNO5/c1-25(2,24(31)27-15-22(29)16-5-11-20(28)12-6-16)32-21-13-7-18(8-14-21)23(30)17-3-9-19(26)10-4-17/h3-14,28H,15H2,1-2H3,(H,27,31) |
| InChIKey | ZGHUGLZHNIYIIU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |