C22H25ClN2O6 — CID 25143517
[3-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-2,2-dimethylpropyl] nitrate (PubChem CID 25143517) has the molecular formula C22H25ClN2O6 and a molecular weight of 448.90 g/mol. Its IUPAC name is [3-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-2,2-dimethylpropyl] nitrate.
| Compound Name | [3-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-2,2-dimethylpropyl] nitrate |
|---|---|
| PubChem CID | 25143517 |
| Molecular Formula | C22H25ClN2O6 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | [3-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-2,2-dimethylpropyl] nitrate |
| SMILES | CC(C)(CNC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)CO[N+](=O)[O-] |
| InChI | InChI=1S/C22H25ClN2O6/c1-21(2,14-30-25(28)29)13-24-20(27)22(3,4)31-18-11-7-16(8-12-18)19(26)15-5-9-17(23)10-6-15/h5-12H,13-14H2,1-4H3,(H,24,27) |
| InChIKey | LVEYGVNFBJGYHV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|