C18H16ClNO5 — CID 58329127
N-[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]oxymethanimine oxide (PubChem CID 58329127) has the molecular formula C18H16ClNO5 and a molecular weight of 361.78 g/mol. Its IUPAC name is N-[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]oxymethanimine oxide.
| Compound Name | N-[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]oxymethanimine oxide |
|---|---|
| PubChem CID | 58329127 |
| Molecular Formula | C18H16ClNO5 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]oxymethanimine oxide |
| SMILES | C=[N+]([O-])OC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H16ClNO5/c1-18(2,17(22)25-20(3)23)24-15-10-6-13(7-11-15)16(21)12-4-8-14(19)9-5-12/h4-11H,3H2,1-2H3 |
| InChIKey | RSEWJDHHZMFHAB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|