C31H25ClO7 — CID 25141788
[3-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-5-hydroxyphenyl] 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate (PubChem CID 25141788) has the molecular formula C31H25ClO7 and a molecular weight of 544.99 g/mol. Its IUPAC name is [3-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-5-hydroxyphenyl] 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate.
| Compound Name | [3-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-5-hydroxyphenyl] 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 25141788 |
| Molecular Formula | C31H25ClO7 |
| Molecular Weight | 544.99 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | [3-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-5-hydroxyphenyl] 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)Oc1cc(O)cc(/C=C/c2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C31H25ClO7/c1-31(2,39-27-11-7-22(8-12-27)29(36)21-5-9-23(32)10-6-21)30(37)38-28-16-20(15-26(35)18-28)4-3-19-13-24(33)17-25(34)14-19/h3-18,33-35H,1-2H3/b4-3+ |
| InChIKey | WVYXTLFDJJWZSY-ONEGZZNKSA-N |
| XLogP | 6.62 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.99 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|