C23H19Cl2NO4 — CID 154646082
2-[4-(4-chlorobenzoyl)phenoxy]-N-(5-chloro-2-hydroxyphenyl)-2-methylpropanamide (PubChem CID 154646082) has the molecular formula C23H19Cl2NO4 and a molecular weight of 444.31 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)phenoxy]-N-(5-chloro-2-hydroxyphenyl)-2-methylpropanamide.
| Compound Name | 2-[4-(4-chlorobenzoyl)phenoxy]-N-(5-chloro-2-hydroxyphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 154646082 |
| Molecular Formula | C23H19Cl2NO4 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)phenoxy]-N-(5-chloro-2-hydroxyphenyl)-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C23H19Cl2NO4/c1-23(2,22(29)26-19-13-17(25)9-12-20(19)27)30-18-10-5-15(6-11-18)21(28)14-3-7-16(24)8-4-14/h3-13,27H,1-2H3,(H,26,29) |
| InChIKey | KXBGPNQIAKBEJU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|