C17H17ClINO2 — CID 1257164
2-(4-chlorophenoxy)-N-(4-iodo-2-methylphenyl)-2-methylpropanamide (PubChem CID 1257164) has the molecular formula C17H17ClINO2 and a molecular weight of 429.69 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(4-iodo-2-methylphenyl)-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(4-iodo-2-methylphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 1257164 |
| Molecular Formula | C17H17ClINO2 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(4-iodo-2-methylphenyl)-2-methylpropanamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClINO2/c1-11-10-13(19)6-9-15(11)20-16(21)17(2,3)22-14-7-4-12(18)5-8-14/h4-10H,1-3H3,(H,20,21) |
| InChIKey | YEKJHUVNVSSSHP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|