C18H18ClNO5 — CID 108764184
2-[3-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-4-hydroxyphenyl]acetic acid (PubChem CID 108764184) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is 2-[3-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-4-hydroxyphenyl]acetic acid.
| Compound Name | 2-[3-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-4-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 108764184 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[3-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]-4-hydroxyphenyl]acetic acid |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)Nc1cc(CC(=O)O)ccc1O |
| InChI | InChI=1S/C18H18ClNO5/c1-18(2,25-13-6-4-12(19)5-7-13)17(24)20-14-9-11(10-16(22)23)3-8-15(14)21/h3-9,21H,10H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | PZEXSOWZGGOFFE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|