C21H21ClO4 — CID 163297688
but-3-enyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate (PubChem CID 163297688) has the molecular formula C21H21ClO4 and a molecular weight of 372.85 g/mol. Its IUPAC name is but-3-enyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate.
| Compound Name | but-3-enyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 163297688 |
| Molecular Formula | C21H21ClO4 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | but-3-enyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| SMILES | C=CCCOC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H21ClO4/c1-4-5-14-25-20(24)21(2,3)26-18-12-8-16(9-13-18)19(23)15-6-10-17(22)11-7-15/h4,6-13H,1,5,14H2,2-3H3 |
| InChIKey | GQFUXPXPDHCNHF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|