About ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate
ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate (PubChem CID 70531737) has the molecular formula C12H19ClO5
and a molecular weight of 278.73 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate.
Molecular Properties
| Compound Name | ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate |
| PubChem CID | 70531737 |
| Molecular Formula | C12H19ClO5 |
| Molecular Weight | 278.73 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1.O.O |
| InChI | InChI=1S/C12H15ClO3.2H2O/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10;;/h5-8H,4H2,1-3H3;2*1H2 |
| InChIKey | WVQLIYBOJSDWBV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 98.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.73 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate?
The IUPAC name of ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate (CID 70531737) is ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate.
What is the SMILES notation for ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate?
The canonical SMILES for ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate is CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1.O.O.
What is the InChIKey of ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate?
The InChIKey is WVQLIYBOJSDWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO3.2H2O/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10;;/h5-8H,4H2,1-3H3;2*1H2.
What are the key properties of ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate?
ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate has a molecular weight of 278.73 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-chlorophenoxy)-2-methylpropanoate;dihydrate is sourced from PubChem (CID 70531737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).