About 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate
1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate (PubChem CID 174991431) has the molecular formula C13H16BrClO3
and a molecular weight of 335.63 g/mol. Its IUPAC name is 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate.
Molecular Properties
| Compound Name | 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate |
| PubChem CID | 174991431 |
| Molecular Formula | C13H16BrClO3 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate |
| SMILES | CCC(Br)OC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16BrClO3/c1-4-11(14)17-12(16)13(2,3)18-10-7-5-9(15)6-8-10/h5-8,11H,4H2,1-3H3 |
| InChIKey | QXPKELHNWGVNPF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate?
The IUPAC name of 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate (CID 174991431) is 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate.
What is the SMILES notation for 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate?
The canonical SMILES for 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate is CCC(Br)OC(=O)C(C)(C)Oc1ccc(Cl)cc1.
What is the InChIKey of 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate?
The InChIKey is QXPKELHNWGVNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrClO3/c1-4-11(14)17-12(16)13(2,3)18-10-7-5-9(15)6-8-10/h5-8,11H,4H2,1-3H3.
What are the key properties of 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate?
1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate has a molecular weight of 335.63 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopropyl 2-(4-chlorophenoxy)-2-methylpropanoate is sourced from PubChem (CID 174991431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).