C20H23ClO6 — CID 174633025
(4-methoxyphenyl) 2-(4-chlorophenoxy)-2-methylpropanoate;propanoic acid (PubChem CID 174633025) has the molecular formula C20H23ClO6 and a molecular weight of 394.85 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-(4-chlorophenoxy)-2-methylpropanoate;propanoic acid.
| Compound Name | (4-methoxyphenyl) 2-(4-chlorophenoxy)-2-methylpropanoate;propanoic acid |
|---|---|
| PubChem CID | 174633025 |
| Molecular Formula | C20H23ClO6 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (4-methoxyphenyl) 2-(4-chlorophenoxy)-2-methylpropanoate;propanoic acid |
| SMILES | CCC(=O)O.COc1ccc(OC(=O)C(C)(C)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H17ClO4.C3H6O2/c1-17(2,22-15-6-4-12(18)5-7-15)16(19)21-14-10-8-13(20-3)9-11-14;1-2-3(4)5/h4-11H,1-3H3;2H2,1H3,(H,4,5) |
| InChIKey | BIADHJPGEQKDEQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|