C10H10ClO3- — CID 6918953
2-(4-chlorophenoxy)-2-methylpropanoate (PubChem CID 6918953) has the molecular formula C10H10ClO3- and a molecular weight of 213.64 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-2-methylpropanoate.
| Compound Name | 2-(4-chlorophenoxy)-2-methylpropanoate |
|---|---|
| PubChem CID | 6918953 |
| Molecular Formula | C10H10ClO3- |
| Molecular Weight | 213.64 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 2-(4-chlorophenoxy)-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)[O-] |
| InChI | InChI=1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13)/p-1 |
| InChIKey | TXCGAZHTZHNUAI-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.64 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |