C12H16NO3- — CID 23123927
2-[4-(2-aminoethyl)phenoxy]-2-methylpropanoate (PubChem CID 23123927) has the molecular formula C12H16NO3- and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)phenoxy]-2-methylpropanoate.
| Compound Name | 2-[4-(2-aminoethyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 23123927 |
| Molecular Formula | C12H16NO3- |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-[4-(2-aminoethyl)phenoxy]-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(CCN)cc1)C(=O)[O-] |
| InChI | InChI=1S/C12H17NO3/c1-12(2,11(14)15)16-10-5-3-9(4-6-10)7-8-13/h3-6H,7-8,13H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | RYEJORVMPOOLGZ-UHFFFAOYSA-M |
| XLogP | 0.10 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |