C18H29NO5 — CID 159171684
ethyl 2-[4-(aminomethyl)phenoxy]-2-methylpropanoate;ethyl propanoate (PubChem CID 159171684) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is ethyl 2-[4-(aminomethyl)phenoxy]-2-methylpropanoate;ethyl propanoate.
| Compound Name | ethyl 2-[4-(aminomethyl)phenoxy]-2-methylpropanoate;ethyl propanoate |
|---|---|
| PubChem CID | 159171684 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | ethyl 2-[4-(aminomethyl)phenoxy]-2-methylpropanoate;ethyl propanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(CN)cc1.CCOC(=O)CC |
| InChI | InChI=1S/C13H19NO3.C5H10O2/c1-4-16-12(15)13(2,3)17-11-7-5-10(9-14)6-8-11;1-3-5(6)7-4-2/h5-8H,4,9,14H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | KLTNZKFDACXOPE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |