C17H12ClF5O3 — CID 524789
(2,3,4,5,6-pentafluorophenyl)methyl 2-(4-chlorophenoxy)-2-methylpropanoate (PubChem CID 524789) has the molecular formula C17H12ClF5O3 and a molecular weight of 394.72 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 2-(4-chlorophenoxy)-2-methylpropanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|---|---|
| PubChem CID | 524789 |
| Molecular Formula | C17H12ClF5O3 |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-(4-chlorophenoxy)-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H12ClF5O3/c1-17(2,26-9-5-3-8(18)4-6-9)16(24)25-7-10-11(19)13(21)15(23)14(22)12(10)20/h3-6H,7H2,1-2H3 |
| InChIKey | LWCTUOXYEKQVKP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|