2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid

C17H14Cl2O6 — CID 154167091

IUPAC2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid
SMILESCCOC(=O)C(Oc1ccc(Cl)cc1)(Oc1ccc(Cl)cc1)C(=O)O
InChIInChI=1S/C17H14Cl2O6/c1-2-23-16(22)17(15(20)21,24-13-7-3-11(18)4-8-13)25-14-9-5-12(19)6-10-14/h3-10H,2H2,1H3,(H,20,21)
InChIKeyJRGXONPTQBRIPY-UHFFFAOYSA-N
MW385.20 g/mol
LogP3.80
Rot. Bonds7

About 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid

2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid (PubChem CID 154167091) has the molecular formula C17H14Cl2O6 and a molecular weight of 385.20 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid.

Molecular Properties

Compound Name2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid
PubChem CID154167091
Molecular FormulaC17H14Cl2O6
Molecular Weight385.20 g/mol
Exact Mass384.02
IUPAC Name2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid
SMILESCCOC(=O)C(Oc1ccc(Cl)cc1)(Oc1ccc(Cl)cc1)C(=O)O
InChIInChI=1S/C17H14Cl2O6/c1-2-23-16(22)17(15(20)21,24-13-7-3-11(18)4-8-13)25-14-9-5-12(19)6-10-14/h3-10H,2H2,1H3,(H,20,21)
InChIKeyJRGXONPTQBRIPY-UHFFFAOYSA-N
XLogP3.80
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500385.20
LogP ≤ 53.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid?
The IUPAC name of 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid (CID 154167091) is 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid.
What is the SMILES notation for 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid?
The canonical SMILES for 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid is CCOC(=O)C(Oc1ccc(Cl)cc1)(Oc1ccc(Cl)cc1)C(=O)O.
What is the InChIKey of 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid?
The InChIKey is JRGXONPTQBRIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2O6/c1-2-23-16(22)17(15(20)21,24-13-7-3-11(18)4-8-13)25-14-9-5-12(19)6-10-14/h3-10H,2H2,1H3,(H,20,21).
What are the key properties of 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid?
2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid has a molecular weight of 385.20 g/mol, XLogP of 3.80, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(4-chlorophenoxy)-3-ethoxy-3-oxopropanoic acid is sourced from PubChem (CID 154167091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).