C15H19ClO4 — CID 103974743
2-(4-chlorophenyl)-2-ethoxycarbonyl-4-methylpentanoic acid (PubChem CID 103974743) has the molecular formula C15H19ClO4 and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-ethoxycarbonyl-4-methylpentanoic acid.
| Compound Name | 2-(4-chlorophenyl)-2-ethoxycarbonyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103974743 |
| Molecular Formula | C15H19ClO4 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(4-chlorophenyl)-2-ethoxycarbonyl-4-methylpentanoic acid |
| SMILES | CCOC(=O)C(CC(C)C)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClO4/c1-4-20-14(19)15(13(17)18,9-10(2)3)11-5-7-12(16)8-6-11/h5-8,10H,4,9H2,1-3H3,(H,17,18) |
| InChIKey | OBWKXKXMXBIBBL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|