C18H23ClO6 — CID 11559746
triethyl (2R)-2-(4-chlorophenyl)propane-1,1,1-tricarboxylate (PubChem CID 11559746) has the molecular formula C18H23ClO6 and a molecular weight of 370.83 g/mol. Its IUPAC name is triethyl (2R)-2-(4-chlorophenyl)propane-1,1,1-tricarboxylate.
| Compound Name | triethyl (2R)-2-(4-chlorophenyl)propane-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 11559746 |
| Molecular Formula | C18H23ClO6 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | triethyl (2R)-2-(4-chlorophenyl)propane-1,1,1-tricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)(C(=O)OCC)[C@H](C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClO6/c1-5-23-15(20)18(16(21)24-6-2,17(22)25-7-3)12(4)13-8-10-14(19)11-9-13/h8-12H,5-7H2,1-4H3/t12-/m1/s1 |
| InChIKey | UMWWJIDIBXGRRO-GFCCVEGCSA-N |
| XLogP | 3.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|