C21H25ClO3 — CID 10713588
ethyl 3-(4-chlorophenyl)-2-methyl-2-(4-propan-2-ylphenoxy)propanoate (PubChem CID 10713588) has the molecular formula C21H25ClO3 and a molecular weight of 360.88 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-2-methyl-2-(4-propan-2-ylphenoxy)propanoate.
| Compound Name | ethyl 3-(4-chlorophenyl)-2-methyl-2-(4-propan-2-ylphenoxy)propanoate |
|---|---|
| PubChem CID | 10713588 |
| Molecular Formula | C21H25ClO3 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-2-methyl-2-(4-propan-2-ylphenoxy)propanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(Cl)cc1)Oc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H25ClO3/c1-5-24-20(23)21(4,14-16-6-10-18(22)11-7-16)25-19-12-8-17(9-13-19)15(2)3/h6-13,15H,5,14H2,1-4H3 |
| InChIKey | WGFXUEDCMGUMJA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |