C30H34O6 — CID 18625725
diethyl 2-[(4-phenylmethoxyphenyl)methyl]-2-(4-propan-2-ylphenoxy)propanedioate (PubChem CID 18625725) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is diethyl 2-[(4-phenylmethoxyphenyl)methyl]-2-(4-propan-2-ylphenoxy)propanedioate.
| Compound Name | diethyl 2-[(4-phenylmethoxyphenyl)methyl]-2-(4-propan-2-ylphenoxy)propanedioate |
|---|---|
| PubChem CID | 18625725 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | diethyl 2-[(4-phenylmethoxyphenyl)methyl]-2-(4-propan-2-ylphenoxy)propanedioate |
| SMILES | CCOC(=O)C(Cc1ccc(OCc2ccccc2)cc1)(Oc1ccc(C(C)C)cc1)C(=O)OCC |
| InChI | InChI=1S/C30H34O6/c1-5-33-28(31)30(29(32)34-6-2,36-27-18-14-25(15-19-27)22(3)4)20-23-12-16-26(17-13-23)35-21-24-10-8-7-9-11-24/h7-19,22H,5-6,20-21H2,1-4H3 |
| InChIKey | FNPYBMAJODEXDF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|