C25H25FO4 — CID 69353995
ethyl 2-(3-fluorophenoxy)-2-methyl-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 69353995) has the molecular formula C25H25FO4 and a molecular weight of 408.47 g/mol. Its IUPAC name is ethyl 2-(3-fluorophenoxy)-2-methyl-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | ethyl 2-(3-fluorophenoxy)-2-methyl-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 69353995 |
| Molecular Formula | C25H25FO4 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl 2-(3-fluorophenoxy)-2-methyl-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(OCc2ccccc2)cc1)Oc1cccc(F)c1 |
| InChI | InChI=1S/C25H25FO4/c1-3-28-24(27)25(2,30-23-11-7-10-21(26)16-23)17-19-12-14-22(15-13-19)29-18-20-8-5-4-6-9-20/h4-16H,3,17-18H2,1-2H3 |
| InChIKey | TXCCQHKQBUYDRI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |