C25H25FO5 — CID 69354009
ethyl 2-(3-fluorophenoxy)-3-hydroxy-2-methyl-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 69354009) has the molecular formula C25H25FO5 and a molecular weight of 424.47 g/mol. Its IUPAC name is ethyl 2-(3-fluorophenoxy)-3-hydroxy-2-methyl-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | ethyl 2-(3-fluorophenoxy)-3-hydroxy-2-methyl-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 69354009 |
| Molecular Formula | C25H25FO5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | ethyl 2-(3-fluorophenoxy)-3-hydroxy-2-methyl-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(C)(Oc1cccc(F)c1)C(O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25FO5/c1-3-29-24(28)25(2,31-22-11-7-10-20(26)16-22)23(27)19-12-14-21(15-13-19)30-17-18-8-5-4-6-9-18/h4-16,23,27H,3,17H2,1-2H3 |
| InChIKey | YYFQJEBBXISDNF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |