C24H22FNO3 — CID 91930691
ethyl 3-(4-fluorophenyl)imino-2-(4-phenylmethoxyphenyl)propanoate (PubChem CID 91930691) has the molecular formula C24H22FNO3 and a molecular weight of 391.44 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)imino-2-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | ethyl 3-(4-fluorophenyl)imino-2-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 91930691 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)imino-2-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(F)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22FNO3/c1-2-28-24(27)23(16-26-21-12-10-20(25)11-13-21)19-8-14-22(15-9-19)29-17-18-6-4-3-5-7-18/h3-16,23H,2,17H2,1H3/b26-16+ |
| InChIKey | AGXHTMZNQSZFLY-WGOQTCKBSA-N |
| XLogP | 5.45 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|