C24H24FNO3 — CID 75092145
ethyl 3-(4-fluoroanilino)-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 75092145) has the molecular formula C24H24FNO3 and a molecular weight of 393.46 g/mol. Its IUPAC name is ethyl 3-(4-fluoroanilino)-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | ethyl 3-(4-fluoroanilino)-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 75092145 |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | ethyl 3-(4-fluoroanilino)-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(Nc1ccc(F)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24FNO3/c1-2-28-24(27)16-23(26-21-12-10-20(25)11-13-21)19-8-14-22(15-9-19)29-17-18-6-4-3-5-7-18/h3-15,23,26H,2,16-17H2,1H3 |
| InChIKey | XQLYXFNQCDDKCI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |