C21H20N2O3 — CID 90940702
3-(4-ethoxyphenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylpropan-1-one (PubChem CID 90940702) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylpropan-1-one.
| Compound Name | 3-(4-ethoxyphenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 90940702 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-(4-ethoxyphenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylpropan-1-one |
| SMILES | CCOc1ccc(/N=C/C(C(=O)c2ccccc2)c2cc(C)no2)cc1 |
| InChI | InChI=1S/C21H20N2O3/c1-3-25-18-11-9-17(10-12-18)22-14-19(20-13-15(2)23-26-20)21(24)16-7-5-4-6-8-16/h4-14,19H,3H2,1-2H3/b22-14+ |
| InChIKey | BQCZCSPLMVGBLV-HYARGMPZSA-N |
| XLogP | 4.75 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|