C20H22O5 — CID 55317467
(1-oxo-1-phenylpropan-2-yl) 3-(4-ethoxyphenoxy)propanoate (PubChem CID 55317467) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 3-(4-ethoxyphenoxy)propanoate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 3-(4-ethoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 55317467 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 3-(4-ethoxyphenoxy)propanoate |
| SMILES | CCOc1ccc(OCCC(=O)OC(C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O5/c1-3-23-17-9-11-18(12-10-17)24-14-13-19(21)25-15(2)20(22)16-7-5-4-6-8-16/h4-12,15H,3,13-14H2,1-2H3 |
| InChIKey | AOBJBSCRBHZQNI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |