About [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate
[1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate (PubChem CID 42898251) has the molecular formula C21H23NO5
and a molecular weight of 369.42 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate.
Molecular Properties
| Compound Name | [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate |
| PubChem CID | 42898251 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate |
| SMILES | CCOc1ccc(C(=O)C(C)OC(=O)C(C)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-4-26-18-12-10-16(11-13-18)19(23)15(3)27-21(25)14(2)22-20(24)17-8-6-5-7-9-17/h5-15H,4H2,1-3H3,(H,22,24) |
| InChIKey | NFFUCECZQSSLAK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate?
The IUPAC name of [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate (CID 42898251) is [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate.
What is the SMILES notation for [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate?
The canonical SMILES for [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate is CCOc1ccc(C(=O)C(C)OC(=O)C(C)NC(=O)c2ccccc2)cc1.
What is the InChIKey of [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate?
The InChIKey is NFFUCECZQSSLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO5/c1-4-26-18-12-10-16(11-13-18)19(23)15(3)27-21(25)14(2)22-20(24)17-8-6-5-7-9-17/h5-15H,4H2,1-3H3,(H,22,24).
What are the key properties of [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate?
[1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate has a molecular weight of 369.42 g/mol, XLogP of 3.02, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-benzamidopropanoate is sourced from PubChem (CID 42898251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).