C19H14Cl2N2O2 — CID 91469949
1-(4-chlorophenyl)-3-(4-chlorophenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)propan-1-one (PubChem CID 91469949) has the molecular formula C19H14Cl2N2O2 and a molecular weight of 373.24 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-chlorophenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)propan-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-(4-chlorophenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 91469949 |
| Molecular Formula | C19H14Cl2N2O2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-chlorophenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)propan-1-one |
| SMILES | Cc1cc(C(/C=N/c2ccc(Cl)cc2)C(=O)c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C19H14Cl2N2O2/c1-12-10-18(25-23-12)17(11-22-16-8-6-15(21)7-9-16)19(24)13-2-4-14(20)5-3-13/h2-11,17H,1H3/b22-11+ |
| InChIKey | ZDLZJPOTYHKIJJ-SSDVNMTOSA-N |
| XLogP | 5.66 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|