C19H15ClN2O2 — CID 91425946
3-(4-chlorophenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylpropan-1-one (PubChem CID 91425946) has the molecular formula C19H15ClN2O2 and a molecular weight of 338.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylpropan-1-one.
| Compound Name | 3-(4-chlorophenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 91425946 |
| Molecular Formula | C19H15ClN2O2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-(4-chlorophenyl)imino-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylpropan-1-one |
| SMILES | Cc1cc(C(/C=N/c2ccc(Cl)cc2)C(=O)c2ccccc2)on1 |
| InChI | InChI=1S/C19H15ClN2O2/c1-13-11-18(24-22-13)17(19(23)14-5-3-2-4-6-14)12-21-16-9-7-15(20)8-10-16/h2-12,17H,1H3/b21-12+ |
| InChIKey | XLEXNXAATFOWQS-CIAFOILYSA-N |
| XLogP | 5.01 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|