C28H20ClFN2O2 — CID 136865812
(2R)-2-(4-benzoylphenyl)-N-[(4-chlorophenyl)iminomethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 136865812) has the molecular formula C28H20ClFN2O2 and a molecular weight of 470.93 g/mol. Its IUPAC name is (2R)-2-(4-benzoylphenyl)-N-[(4-chlorophenyl)iminomethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | (2R)-2-(4-benzoylphenyl)-N-[(4-chlorophenyl)iminomethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 136865812 |
| Molecular Formula | C28H20ClFN2O2 |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (2R)-2-(4-benzoylphenyl)-N-[(4-chlorophenyl)iminomethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(c1ccccc1)c1ccc([C@@H](C(=O)N/C=N/c2ccc(Cl)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H20ClFN2O2/c29-23-12-16-25(17-13-23)31-18-32-28(34)26(20-10-14-24(30)15-11-20)19-6-8-22(9-7-19)27(33)21-4-2-1-3-5-21/h1-18,26H,(H,31,32,34)/t26-/m1/s1 |
| InChIKey | ROHWYWYGTPHXSX-AREMUKBSSA-N |
| XLogP | 6.32 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|