C12H10ClNO2 — CID 15239218
1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone (PubChem CID 15239218) has the molecular formula C12H10ClNO2 and a molecular weight of 235.67 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone |
|---|---|
| PubChem CID | 15239218 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethanone |
| SMILES | Cc1cc(CC(=O)c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C12H10ClNO2/c1-8-6-11(16-14-8)7-12(15)9-2-4-10(13)5-3-9/h2-6H,7H2,1H3 |
| InChIKey | VEMLIEHLAYSQOC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |