C12H10ClIN2O2 — CID 49082320
5-chloro-2-iodo-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzamide (PubChem CID 49082320) has the molecular formula C12H10ClIN2O2 and a molecular weight of 376.58 g/mol. Its IUPAC name is 5-chloro-2-iodo-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzamide.
| Compound Name | 5-chloro-2-iodo-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 49082320 |
| Molecular Formula | C12H10ClIN2O2 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 5-chloro-2-iodo-N-[(3-methyl-1,2-oxazol-5-yl)methyl]benzamide |
| SMILES | Cc1cc(CNC(=O)c2cc(Cl)ccc2I)on1 |
| InChI | InChI=1S/C12H10ClIN2O2/c1-7-4-9(18-16-7)6-15-12(17)10-5-8(13)2-3-11(10)14/h2-5H,6H2,1H3,(H,15,17) |
| InChIKey | MTFHBKJOMZWSCS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|