C11H8ClIN2OS — CID 104579077
5-chloro-2-iodo-N-(1,3-thiazol-5-ylmethyl)benzamide (PubChem CID 104579077) has the molecular formula C11H8ClIN2OS and a molecular weight of 378.62 g/mol. Its IUPAC name is 5-chloro-2-iodo-N-(1,3-thiazol-5-ylmethyl)benzamide.
| Compound Name | 5-chloro-2-iodo-N-(1,3-thiazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 104579077 |
| Molecular Formula | C11H8ClIN2OS |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | 5-chloro-2-iodo-N-(1,3-thiazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1cncs1)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C11H8ClIN2OS/c12-7-1-2-10(13)9(3-7)11(16)15-5-8-4-14-6-17-8/h1-4,6H,5H2,(H,15,16) |
| InChIKey | RMCSHJDLCIWGRC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|