C12H10ClIN2OS — CID 113231985
5-chloro-2-iodo-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide (PubChem CID 113231985) has the molecular formula C12H10ClIN2OS and a molecular weight of 392.65 g/mol. Its IUPAC name is 5-chloro-2-iodo-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide.
| Compound Name | 5-chloro-2-iodo-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 113231985 |
| Molecular Formula | C12H10ClIN2OS |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | 5-chloro-2-iodo-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide |
| SMILES | Cc1ncsc1CNC(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C12H10ClIN2OS/c1-7-11(18-6-16-7)5-15-12(17)9-4-8(13)2-3-10(9)14/h2-4,6H,5H2,1H3,(H,15,17) |
| InChIKey | FLMHOACGDNTENX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|