C13H11ClINOS — CID 52589331
5-chloro-2-iodo-N-[(3-methylthiophen-2-yl)methyl]benzamide (PubChem CID 52589331) has the molecular formula C13H11ClINOS and a molecular weight of 391.66 g/mol. Its IUPAC name is 5-chloro-2-iodo-N-[(3-methylthiophen-2-yl)methyl]benzamide.
| Compound Name | 5-chloro-2-iodo-N-[(3-methylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 52589331 |
| Molecular Formula | C13H11ClINOS |
| Molecular Weight | 391.66 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 5-chloro-2-iodo-N-[(3-methylthiophen-2-yl)methyl]benzamide |
| SMILES | Cc1ccsc1CNC(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C13H11ClINOS/c1-8-4-5-18-12(8)7-16-13(17)10-6-9(14)2-3-11(10)15/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | LNDMEMRURJGCDY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|