C12H11IN2O2S — CID 104628303
3-hydroxy-4-iodo-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide (PubChem CID 104628303) has the molecular formula C12H11IN2O2S and a molecular weight of 374.20 g/mol. Its IUPAC name is 3-hydroxy-4-iodo-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide.
| Compound Name | 3-hydroxy-4-iodo-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 104628303 |
| Molecular Formula | C12H11IN2O2S |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 3-hydroxy-4-iodo-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide |
| SMILES | Cc1ncsc1CNC(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C12H11IN2O2S/c1-7-11(18-6-15-7)5-14-12(17)8-2-3-9(13)10(16)4-8/h2-4,6,16H,5H2,1H3,(H,14,17) |
| InChIKey | ACOWDCVIQWOPRK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|