C11H10IN3O3 — CID 104627817
3-hydroxy-4-iodo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]benzamide (PubChem CID 104627817) has the molecular formula C11H10IN3O3 and a molecular weight of 359.12 g/mol. Its IUPAC name is 3-hydroxy-4-iodo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]benzamide.
| Compound Name | 3-hydroxy-4-iodo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 104627817 |
| Molecular Formula | C11H10IN3O3 |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 3-hydroxy-4-iodo-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| SMILES | Cc1noc(CNC(=O)c2ccc(I)c(O)c2)n1 |
| InChI | InChI=1S/C11H10IN3O3/c1-6-14-10(18-15-6)5-13-11(17)7-2-3-8(12)9(16)4-7/h2-4,16H,5H2,1H3,(H,13,17) |
| InChIKey | SBHAEQIHIYMGSJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|