C12H9ClINO2S — CID 113434669
N-[(5-chlorothiophen-2-yl)methyl]-3-hydroxy-4-iodobenzamide (PubChem CID 113434669) has the molecular formula C12H9ClINO2S and a molecular weight of 393.63 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3-hydroxy-4-iodobenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 113434669 |
| Molecular Formula | C12H9ClINO2S |
| Molecular Weight | 393.63 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3-hydroxy-4-iodobenzamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C12H9ClINO2S/c13-11-4-2-8(18-11)6-15-12(17)7-1-3-9(14)10(16)5-7/h1-5,16H,6H2,(H,15,17) |
| InChIKey | ULWUPICYHSKLHL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|