C15H12ClNO3S — CID 77033251
3-[3-[(5-chlorothiophen-2-yl)methylcarbamoyl]phenyl]prop-2-enoic acid (PubChem CID 77033251) has the molecular formula C15H12ClNO3S and a molecular weight of 321.79 g/mol. Its IUPAC name is 3-[3-[(5-chlorothiophen-2-yl)methylcarbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(5-chlorothiophen-2-yl)methylcarbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77033251 |
| Molecular Formula | C15H12ClNO3S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 3-[3-[(5-chlorothiophen-2-yl)methylcarbamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(C(=O)NCc2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C15H12ClNO3S/c16-13-6-5-12(21-13)9-17-15(20)11-3-1-2-10(8-11)4-7-14(18)19/h1-8H,9H2,(H,17,20)(H,18,19) |
| InChIKey | ULVAFWQQKRNVIW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|