C12H8Br2ClNOS — CID 114023582
3,5-dibromo-N-[(5-chlorothiophen-2-yl)methyl]benzamide (PubChem CID 114023582) has the molecular formula C12H8Br2ClNOS and a molecular weight of 409.53 g/mol. Its IUPAC name is 3,5-dibromo-N-[(5-chlorothiophen-2-yl)methyl]benzamide.
| Compound Name | 3,5-dibromo-N-[(5-chlorothiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 114023582 |
| Molecular Formula | C12H8Br2ClNOS |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 406.84 |
| IUPAC Name | 3,5-dibromo-N-[(5-chlorothiophen-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H8Br2ClNOS/c13-8-3-7(4-9(14)5-8)12(17)16-6-10-1-2-11(15)18-10/h1-5H,6H2,(H,16,17) |
| InChIKey | ZYEIJIVVJPSHGH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |