C11H8BrClN2OS — CID 62998517
5-bromo-N-[(5-chlorothiophen-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 62998517) has the molecular formula C11H8BrClN2OS and a molecular weight of 331.62 g/mol. Its IUPAC name is 5-bromo-N-[(5-chlorothiophen-2-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-[(5-chlorothiophen-2-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62998517 |
| Molecular Formula | C11H8BrClN2OS |
| Molecular Weight | 331.62 g/mol |
| Exact Mass | 329.92 |
| IUPAC Name | 5-bromo-N-[(5-chlorothiophen-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1ccc(Br)cn1 |
| InChI | InChI=1S/C11H8BrClN2OS/c12-7-1-3-9(14-5-7)11(16)15-6-8-2-4-10(13)17-8/h1-5H,6H2,(H,15,16) |
| InChIKey | GQAKIZCQYCSNHU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |