C11H10BrN3O3S2 — CID 62958487
5-bromo-N-[(5-sulfamoylthiophen-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 62958487) has the molecular formula C11H10BrN3O3S2 and a molecular weight of 376.26 g/mol. Its IUPAC name is 5-bromo-N-[(5-sulfamoylthiophen-2-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-[(5-sulfamoylthiophen-2-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62958487 |
| Molecular Formula | C11H10BrN3O3S2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 5-bromo-N-[(5-sulfamoylthiophen-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2ccc(Br)cn2)s1 |
| InChI | InChI=1S/C11H10BrN3O3S2/c12-7-1-3-9(14-5-7)11(16)15-6-8-2-4-10(19-8)20(13,17)18/h1-5H,6H2,(H,15,16)(H2,13,17,18) |
| InChIKey | FQAYQMWNYRJTJB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |