C10H7BrClNOS2 — CID 32775594
N-[(5-bromothiophen-2-yl)methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 32775594) has the molecular formula C10H7BrClNOS2 and a molecular weight of 336.66 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 32775594 |
| Molecular Formula | C10H7BrClNOS2 |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 334.88 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(Br)s1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H7BrClNOS2/c11-8-3-1-6(15-8)5-13-10(14)7-2-4-9(12)16-7/h1-4H,5H2,(H,13,14) |
| InChIKey | AJJVYOITZUUPPN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |