C11H11BrN2OS2 — CID 61139794
4-amino-N-[(5-bromothiophen-2-yl)methyl]-5-methylthiophene-2-carboxamide (PubChem CID 61139794) has the molecular formula C11H11BrN2OS2 and a molecular weight of 331.26 g/mol. Its IUPAC name is 4-amino-N-[(5-bromothiophen-2-yl)methyl]-5-methylthiophene-2-carboxamide.
| Compound Name | 4-amino-N-[(5-bromothiophen-2-yl)methyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 61139794 |
| Molecular Formula | C11H11BrN2OS2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | 4-amino-N-[(5-bromothiophen-2-yl)methyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCc2ccc(Br)s2)cc1N |
| InChI | InChI=1S/C11H11BrN2OS2/c1-6-8(13)4-9(16-6)11(15)14-5-7-2-3-10(12)17-7/h2-4H,5,13H2,1H3,(H,14,15) |
| InChIKey | DYPXTOLVDVDBMU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |