C11H9BrClNOS2 — CID 103401936
N-[(5-bromothiophen-2-yl)methyl]-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 103401936) has the molecular formula C11H9BrClNOS2 and a molecular weight of 350.69 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103401936 |
| Molecular Formula | C11H9BrClNOS2 |
| Molecular Weight | 350.69 g/mol |
| Exact Mass | 348.90 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NCc2ccc(Br)s2)c1Cl |
| InChI | InChI=1S/C11H9BrClNOS2/c1-6-5-16-10(9(6)13)11(15)14-4-7-2-3-8(12)17-7/h2-3,5H,4H2,1H3,(H,14,15) |
| InChIKey | ZHZKKNMTLKNAFY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |