C10H13BrClNOS — CID 106846016
N-(4-bromobutyl)-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 106846016) has the molecular formula C10H13BrClNOS and a molecular weight of 310.64 g/mol. Its IUPAC name is N-(4-bromobutyl)-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-(4-bromobutyl)-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 106846016 |
| Molecular Formula | C10H13BrClNOS |
| Molecular Weight | 310.64 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | N-(4-bromobutyl)-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NCCCCBr)c1Cl |
| InChI | InChI=1S/C10H13BrClNOS/c1-7-6-15-9(8(7)12)10(14)13-5-3-2-4-11/h6H,2-5H2,1H3,(H,13,14) |
| InChIKey | HBRSOUMDVSQACK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|